CAS 326177-41-7

[1-(PHENYLSULFONYL)-4-PIPERIDINYL](PIPERIDINO)METHANONE

Description:

The chemical substance known as [1-(phenylsulfonyl)-4-piperidinyl](piperidino)methanone, with the CAS number 326177-41-7, is a synthetic compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is characterized by the presence of a phenylsulfonyl group, which enhances its chemical reactivity and potential biological activity. This compound may exhibit properties such as being a potential pharmacological agent, possibly influencing neurotransmitter systems due to its structural similarity to other biologically active piperidine compounds. Its sulfonyl group can contribute to its solubility and interaction with biological targets. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. However, specific biological activities, toxicity, and therapeutic applications would require further investigation through empirical studies and clinical trials.

Formula: C₁₇H₂₄N₂O₃S

InChI: InChI=1S/C17H24N2O3S/c20-17(18-11-5-2-6-12-18)15-9-13-19(14-10-15)23(21,22)16-7-3-1-4-8-16/h1,3-4,7-8,15H,2,5-6,9-14H2

InChI key: MEMBANHWJBJTNM-UHFFFAOYSA-N

SMILES: C1CCN(CC1)C(=O)C2CCN(CC2)S(=O)(=O)C3=CC=CC=C3

Synonyms:

• Piperidine, 1-[[1-(phenylsulfonyl)-4-piperidinyl]carbonyl]- (9CI)
• [1-(PHENYLSULFONYL)-4-PIPERIDINYL](PIPERIDINO)METHANONE