CAS 326182-61-0

3-Amino-4-chloro-N-(2-fluorophenyl)benzenesulfonamide

Description:

3-Amino-4-chloro-N-(2-fluorophenyl)benzenesulfonamide is a sulfonamide compound characterized by the presence of an amino group, a chloro substituent, and a fluorophenyl moiety attached to a benzenesulfonamide core. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, due to its structural similarity to sulfanilamide, a well-known antibiotic. The presence of the amino group enhances its solubility in polar solvents, while the chloro and fluorine substituents can influence its reactivity and biological activity. The compound may also exhibit moderate to high melting points and stability under standard laboratory conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. As with many sulfonamides, it is essential to consider its pharmacokinetics, toxicity, and environmental impact during research and application.

Formula: C₁₂H₁₀ClFN₂O₂S

InChI: InChI=1S/C12H10ClFN2O2S/c13-9-6-5-8(7-11(9)15)19(17,18)16-12-4-2-1-3-10(12)14/h1-7,16H,15H2

InChI key: InChIKey=KLBHHGHDAPFCRH-UHFFFAOYSA-N

SMILES: S(NC1=C(F)C=CC=C1)(=O)(=O)C2=CC(N)=C(Cl)C=C2

Synonyms:

• 3-Amino-4-chloro-N-(2-fluorophenyl)benzenesulfonamide
• Benzenesulfonamide, 3-amino-4-chloro-N-(2-fluorophenyl)-
• 3-AMINO-4-CHLORO-N-(2-FLUORO-PHENYL)-BENZENESULFONAMIDE
• 3-amino-4-chloro-N-(2-fluorophenyl)benzene-1-sulfonamide