CAS 326182-69-8

3-[[[2-Chloro-5-(trifluoromethyl)phenyl]amino]sulfonyl]benzoic acid

Description:

3-[[[2-Chloro-5-(trifluoromethyl)phenyl]amino]sulfonyl]benzoic acid, identified by its CAS number 326182-69-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a sulfonamide functional group. This compound features a chloro substituent and a trifluoromethyl group on the aromatic ring, contributing to its unique chemical properties. The presence of the sulfonamide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as sulfonamides are known for their antibacterial properties. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity and solubility. Additionally, the chlorine atom may affect the electronic properties of the molecule, potentially impacting its reactivity and interaction with biological targets. Overall, this compound's distinctive functional groups and structural features make it of interest in various fields, including drug design and agrochemicals.

Formula: C₁₄H₉ClF₃NO₄S

InChI: InChI=1S/C14H9ClF3NO4S/c15-11-5-4-9(14(16,17)18)7-12(11)19-24(22,23)10-3-1-2-8(6-10)13(20)21/h1-7,19H,(H,20,21)

InChI key: InChIKey=KJQMJTKIOYXMAZ-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC(C(O)=O)=CC=C1)C2=CC(C(F)(F)F)=CC=C2Cl

Synonyms:

• Benzoic acid, 3-[[[2-chloro-5-(trifluoromethyl)phenyl]amino]sulfonyl]-
• 3-[[[2-Chloro-5-(trifluoromethyl)phenyl]amino]sulfonyl]benzoic acid