CAS 3262-89-3
:Triphenylboroxin
Description:
Triphenylboroxin, with the CAS number 3262-89-3, is an organoboron compound characterized by its unique structure, which features a boron atom bonded to three phenyl groups and an oxygen atom. This compound typically exists as a colorless to pale yellow solid and is known for its stability under ambient conditions. Triphenylboroxin exhibits interesting chemical properties, including the ability to act as a Lewis acid due to the electron-deficient nature of the boron atom. It can participate in various chemical reactions, including coordination with nucleophiles and polymerization processes. Additionally, triphenylboroxin is utilized in organic synthesis and materials science, particularly in the development of boron-containing polymers and as a reagent in organic reactions. Its solubility in organic solvents makes it versatile for various applications in chemical research and industry. However, like many organoboron compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C18H15B3O3
InChI:InChI=1/C18H15B3O3/c1-4-10-16(11-5-1)19-22-20(17-12-6-2-7-13-17)24-21(23-19)18-14-8-3-9-15-18/h1-15H
SMILES:c1ccc(cc1)B1OB(c2ccccc2)OB(c2ccccc2)O1
Synonyms:- 2,4,6-Triphenylboroxin
- Boroxin, 2,4,6-Triphenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4,6-Triphenylboroxin
CAS:Formula:C18H15B3O3Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:311.752,4,6-Triphenyl-1,3,5,2,4,6-trioxatriborinane
CAS:Formula:C18H15B3O3Purity:98%Color and Shape:SolidMolecular weight:311.7429Phenyl boronic acid anhydride
CAS:Phenyl boronic acid anhydridePurity:98%Color and Shape:White PowderMolecular weight:311.74g/mol2,4,6-Triphenyl-1,3,5,2,4,6-trioxatriborinane
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:311.752,4,6-Triphenylboroxin
CAS:<p>Please enquire for more information about 2,4,6-Triphenylboroxin including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C18H15B3O3Molecular weight:311.74 g/mol2,4,6-Triphenylboroxin
CAS:<p>2,4,6-Triphenylboroxin is a diphenyl ether boron compound that reacts with hydroxyl groups to form hydrogen bonds. Boron is a chemical element that has the symbol B and atomic number 5. It is a solid at room temperature and its color ranges from white to dark green. Boron is also used as an insecticide in organic farming. 2,4,6-Triphenylboroxin has been shown to chelate metal ions such as copper and iron, which makes it useful for research in carbohydrate chemistry and fatty acid synthesis. 2,4,6-Triphenylboroxin can be synthesized by reacting phenylmagnesium bromide with diphenyl ether. This reaction mechanism was first proposed by Friedel and Crafts in 1877. The product of this reaction contains nitrogen atoms that are used as chelating ligands to bind metals such as copper or iron. 2,4,6-</p>Formula:C18H15B3O3Purity:Min. 95%Molecular weight:311.74 g/mol




