CymitQuimica logo

CAS 32631-29-1

:

4-[(4-chlorophenyl)sulfanyl]aniline

Description:
4-[(4-Chlorophenyl)sulfanyl]aniline, also known by its CAS number 32631-29-1, is an organic compound characterized by the presence of an aniline group substituted with a 4-chlorophenyl sulfanyl moiety. This compound features a sulfenyl linkage, which contributes to its reactivity and potential applications in various chemical reactions. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chlorophenyl group can influence its electronic properties, making it a candidate for use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which warrants further investigation into its potential uses in medicinal chemistry. Safety data should be consulted, as compounds with similar structures can exhibit toxicity or environmental hazards. Overall, 4-[(4-chlorophenyl)sulfanyl]aniline is a compound of interest in both academic and industrial chemistry contexts.
Formula:C12H10ClNS
InChI:InChI=1/C12H10ClNS/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H,14H2
InChI key:DVTZWUZZYSGZLE-UHFFFAOYSA-N
SMILES:c1cc(ccc1Cl)Sc1ccc(cc1)N
Synonyms:
  • 4-Amino-4'-chloro diphenyl sulfide
  • Benzenamine, 4-[(4-Chlorophenyl)Thio]-
  • 4-[(4-Chlorophenyl)sulfanyl]aniline
Found 5 products.