CAS 3264-21-9
:1-Acetylpyrene
Description:
1-Acetylpyrene is an organic compound belonging to the polycyclic aromatic hydrocarbon family, characterized by its structure that includes a pyrene moiety with an acetyl group attached. It is typically a yellow to orange crystalline solid, exhibiting a relatively high melting point. This compound is known for its fluorescence properties, making it useful in various applications, including as a fluorescent probe in biochemical studies. 1-Acetylpyrene is soluble in organic solvents such as acetone and ethanol but has limited solubility in water. Its chemical formula is C15H10O, and it has a molecular weight that reflects its complex structure. The compound is of interest in research due to its potential role in studies related to environmental chemistry and the behavior of polycyclic aromatic hydrocarbons in biological systems. However, like many polycyclic aromatic compounds, it may pose environmental and health risks, necessitating careful handling and disposal.
Formula:C18H12O
InChI:InChI=1/C18H12O/c1-11(19)15-9-7-14-6-5-12-3-2-4-13-8-10-16(15)18(14)17(12)13/h2-10H,1H3
Synonyms:- Ethanone, 1-(1-pyrenyl)-
- Nsc 62422
- 1-(Pyren-1-Yl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Acetylpyrene, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C18H12OPurity:97%Color and Shape:Crystals or powder or crystalline powder or flakes, Yellow to pale brownMolecular weight:244.29
