CAS 32644-30-7

4-amino-1-methyl-5H-chromeno[3,4-c]pyridin-5-one

Description:

4-Amino-1-methyl-5H-chromeno[3,4-c]pyridin-5-one, with CAS number 32644-30-7, is a heterocyclic organic compound characterized by its fused chromene and pyridine structures. This compound features an amino group and a methyl group, contributing to its reactivity and potential biological activity. It typically exhibits a solid state at room temperature and is soluble in polar organic solvents, which is common for compounds with similar structures. The presence of the amino group suggests potential for hydrogen bonding, influencing its solubility and interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural motifs, which are often associated with various pharmacological activities. Additionally, its unique chromeno-pyridine framework may provide avenues for further chemical modifications, enhancing its therapeutic potential. Overall, 4-amino-1-methyl-5H-chromeno[3,4-c]pyridin-5-one represents a versatile scaffold for research in drug development and organic synthesis.

Formula: C₁₃H₁₀N₂O₂

InChI: InChI=1/C13H10N2O2/c1-7-6-15-12(14)11-10(7)8-4-2-3-5-9(8)17-13(11)16/h2-6H,1H3,(H2,14,15)

SMILES: Cc1c[nH]c(=N)c2c1c1ccccc1oc2=O

4-amino-1-methyl-5H-chromeno[3,4-c]pyridin-5-one

CAS: 32644-30-7

Purity: 95.0%

Molecular weight: 226.23500061035156

Ref: 10-F315279