CAS 326480-00-6

tert-butyl [(2R,3S)-3-{[tert-butyl(dimethyl)silyl]oxy}-1,4-dichlorobutan-2-yl]carbamate

Description:

Tert-butyl [(2R,3S)-3-{[tert-butyl(dimethyl)silyl]oxy}-1,4-dichlorobutan-2-yl]carbamate is a complex organic compound characterized by its unique structural features. It contains a tert-butyl group, which contributes to its hydrophobic properties, and a carbamate functional group, indicating potential reactivity in biological systems. The presence of a dichlorobutane moiety suggests that it may exhibit specific reactivity patterns, particularly in nucleophilic substitution reactions. The silyl ether functionality, derived from the tert-butyl(dimethyl)silyl group, enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. The stereochemistry indicated by the (2R,3S) configuration suggests that the compound may exhibit chirality, which can influence its biological activity and interactions. Overall, this compound's characteristics make it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where selective reactivity and stability are crucial.

Formula: C₁₅H₃₁Cl₂NO₃Si

InChI: InChI=1/C15H31Cl2NO3Si/c1-14(2,3)20-13(19)18-11(9-16)12(10-17)21-22(7,8)15(4,5)6/h11-12H,9-10H2,1-8H3,(H,18,19)/t11-,12+/m0/s1

InChI key: VOECCWQELBNMEF-NWDGAFQWSA-N

SMILES: CC(C)(C)OC(=O)N[C@@H](CCl)[C@@H](CCl)O[Si](C)(C)C(C)(C)C