CAS 326496-01-9

5-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methyl-pyridin-2-amine

Description:

5-Bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methyl-pyridin-2-amine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and an amine group. The presence of the tert-butyl(dimethyl)silyl group indicates that the compound has significant steric bulk, which can influence its reactivity and solubility. This silyl group is often used to enhance the stability of the compound and protect functional groups during chemical reactions. The compound's amine functionality suggests potential basic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the bromine substituent can serve as a leaving group in reactions, facilitating further synthetic transformations. The compound's unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Overall, the characteristics of this compound highlight its potential utility in organic synthesis and pharmaceutical applications.

Formula: C₁₄H₂₅BrN₂OSi

InChI: InChI=1/C14H25BrN2OSi/c1-14(2,3)19(5,6)18-10-9-17(4)13-8-7-12(15)11-16-13/h7-8,11H,9-10H2,1-6H3

SMILES: CC(C)(C)[Si](C)(C)OCCN(C)c1ccc(cn1)Br

Synonyms:

• 5-Bromo-N-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-N-methyl-2-pyridinamine
• 2-Pyridinamine, 5-bromo-N-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-N-methyl-
• (5-Bromopyridin-2-yl)[2-(tert-butyldimethylsilyloxy)ethyl]methylamine

(5-Bromopyridin-2-yl)[2-(tert-butyldimethylsilyloxy)ethyl]methylamine

Controlled Product

CAS: 326496-01-9

Applications (5-Bromopyridin-2-yl)[2-(tert-butyldimethylsilyloxy)ethyl]methylamine (cas# 326496-01-9) is a compound useful in organic synthesis.

Formula: C₁₄H₂₅BrN₂OSi

Color and Shape: Neat

Molecular weight: 345.35

Ref: TR-B686790