CAS 326496-02-0
:6-[[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]methylamino]-3-pyridinol
Description:
6-[[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]methylamino]-3-pyridinol, with CAS number 326496-02-0, is a chemical compound characterized by its complex structure that includes a pyridine ring, a siloxy group, and an amino group. This compound typically exhibits properties associated with both organic and organosilicon chemistry, including potential solubility in organic solvents and stability under various conditions. The presence of the dimethylsilyl group suggests that it may have unique reactivity and interactions due to the silicon atom, which can influence its physical and chemical properties, such as volatility and hydrophobicity. Additionally, the amino group may impart basicity and potential for hydrogen bonding, affecting its behavior in biological systems or as a reagent in synthetic chemistry. Overall, this compound may find applications in pharmaceuticals, materials science, or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C14H26N2O2Si
InChI:InChI=1S/C14H26N2O2Si/c1-14(2,3)19(5,6)18-10-9-16(4)13-8-7-12(17)11-15-13/h7-8,11,17H,9-10H2,1-6H3
InChI key:InChIKey=AMPWJIFLTYOKOL-UHFFFAOYSA-N
SMILES:N(CCO[Si](C(C)(C)C)(C)C)(C)C1=CC=C(O)C=N1
Synonyms:- 6-[[2-(tert-Butyldimethylsilyloxy)ethyl]methylamino]pyridin-3-ol
- 6-[[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]methylamino]-3-pyridinol
- 3-Pyridinol, 6-[[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]methylamino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-[[2-(tert-Butyldimethylsilyloxy)ethyl]methylamino]pyridin-3-ol
CAS:Controlled Product<p>Applications 6-[[2-(tert-Butyldimethylsilyloxy)ethyl]methylamino]pyridin-3-ol (cas# 326496-02-0) is a compound useful in organic synthesis.<br></p>Formula:C14H26N2O2SiColor and Shape:NeatMolecular weight:282.45
