CAS 3265-23-4

(3E)-3-hydrazono-1-methyl-1,3-dihydro-2H-indol-2-one

Description:

(3E)-3-hydrazono-1-methyl-1,3-dihydro-2H-indol-2-one, with the CAS number 3265-23-4, is a chemical compound that belongs to the class of indole derivatives. This substance features a hydrazone functional group, which is characterized by the presence of a hydrazine moiety (–NH–NH–) bonded to a carbonyl group. The compound exhibits a bicyclic structure typical of indoles, contributing to its potential biological activity. It is generally recognized for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound may exhibit properties such as antioxidant, anti-inflammatory, or antimicrobial activities, although specific biological effects can vary based on structural modifications and the presence of substituents. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental conditions such as pH and temperature. Proper handling and safety measures should be observed when working with this compound in laboratory settings.

Formula: C₉H₉N₃O

InChI: InChI=1/C9H9N3O/c1-12-7-5-3-2-4-6(7)8(11-10)9(12)13/h2-5H,10H2,1H3/b11-8+

1-Methyl-1H-indole-2,3-dione 3-hydrazone

CAS: 3265-23-4

1-Methyl-1H-indole-2,3-dione 3-hydrazone

Purity: 95%

Molecular weight: 175.19g/mol

Ref: 54-OR1006169

1-Methyl-1H-indole-2,3-dione 3-hydrazone

CAS: 3265-23-4

Purity: 95%

Molecular weight: 175.191

Ref: 10-F988577

3-Hydrazinylidene-1-methyl-2,3-dihydro-1H-indol-2-one

CAS: 3265-23-4

Please enquire for more information about 3-Hydrazinylidene-1-methyl-2,3-dihydro-1H-indol-2-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₉N₃O

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-DAA26523