CAS 3265-58-5

2,6-Dimethyl-4-oxo-4H-pyran-3-carboxylic acid

Description:

2,6-Dimethyl-4-oxo-4H-pyran-3-carboxylic acid, with the CAS number 3265-58-5, is a chemical compound that belongs to the class of pyran derivatives. This substance features a pyran ring, which is a six-membered heterocyclic structure containing one oxygen atom. The presence of two methyl groups at the 2 and 6 positions contributes to its unique properties, while the carboxylic acid functional group at the 3 position enhances its reactivity and solubility in polar solvents. The keto group at the 4 position adds to its stability and potential for tautomerization. This compound may exhibit biological activity, making it of interest in medicinal chemistry and organic synthesis. Its structural characteristics suggest potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific information regarding its toxicity, environmental impact, and detailed reactivity would require further investigation and analysis.

Formula: C₈H₈O₄

InChI: InChI=1S/C8H8O4/c1-4-3-6(9)7(8(10)11)5(2)12-4/h3H,1-2H3,(H,10,11)

InChI key: InChIKey=MZMRFDKQPOMOGX-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=O)C=C(C)OC1C

Synonyms:

• 4H-Pyran-3-carboxylic acid, 2,6-dimethyl-4-oxo-
• 2,6-Dimethyl-4-oxopyran-3-carboxylic acid
• 2,6-Dimethyl-4-oxo-4H-pyran-3-carboxylic acid
• 2,6-Dimethyl-4-pyrone-3-carboxylic acid