
CAS 326615-15-0
:3,3-Difluoro-4-(2-furanyl)-1-[(4-methoxyphenyl)methyl]-2-azetidinone
Description:
3,3-Difluoro-4-(2-furanyl)-1-[(4-methoxyphenyl)methyl]-2-azetidinone is a synthetic organic compound characterized by its unique structural features, including a four-membered azetidinone ring, which contributes to its potential biological activity. The presence of difluoro substituents enhances its lipophilicity and may influence its interaction with biological targets. The furan ring and the methoxyphenyl group introduce additional functional diversity, potentially affecting the compound's solubility, stability, and reactivity. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. The compound's CAS number, 326615-15-0, allows for easy identification and retrieval of information in chemical databases. Overall, the unique combination of functional groups and structural characteristics positions this compound as a subject of interest in both synthetic and medicinal chemistry.
Formula:C15H13F2NO3
InChI:InChI=1S/C15H13F2NO3/c1-20-11-6-4-10(5-7-11)9-18-13(12-3-2-8-21-12)15(16,17)14(18)19/h2-8,13H,9H2,1H3
InChI key:InChIKey=CRPMJISKIODOLQ-UHFFFAOYSA-N
SMILES:C(N1C(C(F)(F)C1=O)C2=CC=CO2)C3=CC=C(OC)C=C3
Synonyms:- 3,3-Difluoro-4-(2-furanyl)-1-[(4-methoxyphenyl)methyl]-2-azetidinone
- 2-Azetidinone, 3,3-difluoro-4-(2-furanyl)-1-[(4-methoxyphenyl)methyl]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery