CAS 32664-13-4
:2-(2-bromophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole
Description:
2-(2-Bromophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of the 2-bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, contributing to the compound's reactivity and potential applications in organic synthesis. The dimethyl groups at the 4-position of the oxazole ring enhance its steric properties and may influence its solubility and stability. This compound is typically of interest in medicinal chemistry and materials science due to its unique structural features, which can affect biological activity and physical properties. Its molecular structure suggests potential for various interactions, making it a candidate for further research in drug development or as a building block in organic synthesis. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C11H12BrNO
InChI:InChI=1/C11H12BrNO/c1-11(2)7-14-10(13-11)8-5-3-4-6-9(8)12/h3-6H,7H2,1-2H3
SMILES:CC1(C)COC(=N1)c1ccccc1Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Bromophenyl)-4,5-dihydro-4,4-dimethyloxazole
CAS:Formula:C11H12BrNOPurity:96%Color and Shape:SolidMolecular weight:254.12312-(2-Bromophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole
CAS:2-(2-Bromophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazolePurity:96%Molecular weight:254.12g/mol2-(2-BROMOPHENYL)-4,5-DIHYDRO-4,4-DIMETHYLOXAZOLE
CAS:Formula:C11H12BrNOPurity:96%Molecular weight:254.1272-(2-Bromophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole
CAS:2-(2-Bromophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole is an aryl boronic acid that can be synthesized by a Suzuki reaction with an alkyl halide and sodium carbonate. This compound is used as a reagent in organic synthesis for the production of various pharmaceuticals. The most common use of this chemical is for the synthesis of angiotensin II antagonists. 2-(2-Bromophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole has also been shown to be a selective antagonist of angiotensin II type 1 receptors.Formula:C11H12BrNOPurity:Min. 95%Molecular weight:254.12 g/mol




