CAS 32669-06-0
:2-Chloroethyl Benzhydryl Ether
Description:
2-Chloroethyl Benzhydryl Ether, with the CAS number 32669-06-0, is an organic compound characterized by its ether functional group and the presence of a chloroethyl moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The presence of the chloroethyl group imparts reactivity, making it a potential intermediate in organic synthesis, particularly in the formation of other chemical entities. Additionally, the benzhydryl group contributes to its stability and can influence its reactivity in nucleophilic substitution reactions. Safety considerations should be taken into account, as compounds containing chlorine can pose health risks, including potential toxicity and environmental hazards. Proper handling and storage in a well-ventilated area, along with the use of personal protective equipment, are recommended when working with this substance.
Formula:C15H15ClO
InChI:InChI=1/C15H15ClO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2
SMILES:c1ccc(cc1)C(c1ccccc1)OCCCl
Synonyms:- Benzhydryl 2-chloroethyl ether
- 1,1'-[(2-Chloroethoxy)Methanediyl]Dibenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloroethyl benzhydryl ether
CAS:Formula:C15H15ClOPurity:95%Color and Shape:SolidMolecular weight:246.7320[(2-Chloroethoxy)(phenyl)methyl]benzene
CAS:[(2-Chloroethoxy)(phenyl)methyl]benzenePurity:95%Molecular weight:246.74g/mol[(2-Chloroethoxy)(phenyl)methyl]benzene
CAS:Formula:C15H15ClOPurity:95%Color and Shape:Low Melting SolidMolecular weight:246.732-Chloroethyl Benzhydryl Ether
CAS:Controlled ProductApplications Diphenhydramine hydrochloride (D486900) related compound.
References Zhang, Y., et al.: J. Med. Chem., 43, 4840 (2000), Schmitt, K., et al.: J. Neurochem., 107, 928 (2008),Formula:C15H15ClOColor and Shape:NeatMolecular weight:246.73




