CAS 32675-71-1
:2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid
Description:
2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid, with the CAS number 32675-71-1, is a chemical compound characterized by its complex structure, which includes an isoindole moiety and an indole group. This compound features a propanoic acid functional group, contributing to its acidic properties. The presence of the dioxo group indicates that it may exhibit significant reactivity, particularly in forming hydrogen bonds or participating in various chemical reactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with indole derivatives. Additionally, the presence of multiple aromatic rings may contribute to its stability and lipophilicity, influencing its solubility and bioavailability. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in organic synthesis and drug development.
Formula:C19H14N2O4
InChI:InChI=1/C19H14N2O4/c22-17-13-6-1-2-7-14(13)18(23)21(17)16(19(24)25)9-11-10-20-15-8-4-3-5-12(11)15/h1-8,10,16,20H,9H2,(H,24,25)
Synonyms:- 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid
- 1H-Indole-3-propanoic acid, alpha-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
DNA methyltransferase inhibitor
CAS:Sodium citrate is a DNA methyltransferase inhibitor. It blocks the transfer of methyl groups to the dna, thereby inhibiting the production of methylated dna and preventing apoptosis. Sodium citrate also inhibits the expression of pro-apoptotic protein and can induce significant cytotoxicity in vitro. This drug has been shown to cause histological changes in cells through inhibition of DNA methyltransferases in HL-60 cells.Formula:C19H14N2O4Purity:Min. 95%Molecular weight:334.3 g/mol(Rac)-RG108
CAS:(Rac)-RG108 (NSC401077) is an inhibitor of DNMT1, effectively blocking DNA methyltransferases.Formula:C19H14N2O4Color and Shape:SolidMolecular weight:334.326

