CAS 3268-61-9

2,7-dimethylimidazo[1,2-a]pyridine

Description:

2,7-Dimethylimidazo[1,2-a]pyridine (CAS 3268-61-9) is a heterocyclic aromatic compound known for its potential role as a carcinogen. It features a fused imidazole and pyridine ring structure, with two methyl groups located at the 2 and 7 positions of the imidazo ring. This compound is typically formed during the cooking of certain meats at high temperatures, particularly through the Maillard reaction, which occurs between amino acids and reducing sugars. Its molecular formula is C10H10N2, and it has a relatively low water solubility, making it more soluble in organic solvents. The compound is of interest in toxicology and food safety due to its mutagenic properties, which have been studied in various biological systems. Additionally, 2,7-dimethylimidazo[1,2-a]pyridine is often used as a model compound in research to understand the mechanisms of carcinogenesis and the effects of dietary components on health. Proper handling and safety measures are essential when working with this substance due to its potential health risks.

Formula: C₉H₁₀N₂

InChI: InChI=1/C9H10N2/c1-7-3-4-11-6-8(2)10-9(11)5-7/h3-6H,1-2H3

SMILES: Cc1ccn2cc(C)nc2c1

2,7-Dimethyl-imidazo[1,2-a]pyridine

CAS: 3268-61-9

Formula: C₉H₁₀N₂

Purity: 95%

Molecular weight: 146.1891

Ref: IN-DA00BXZM

2,7-Dimethylimidazo[1,2-a]pyridine

CAS: 3268-61-9

2,7-Dimethylimidazo[1,2-a]pyridine

Purity: ≥95%

Molecular weight: 146.19g/mol

Ref: 54-OR302250

2,7-Dimethylimidazo[1,2-a]pyridine

CAS: 3268-61-9

Formula: C₉H₁₀N₂

Purity: ≥95%

Molecular weight: 146.193

Ref: 10-F383576