CAS 32685-16-8
:Benzamide, N-hydroxy-, potassium salt (1:1)
Description:
Benzamide, N-hydroxy-, potassium salt (1:1) is a chemical compound characterized by its structure, which includes a benzamide moiety with a hydroxyl group attached to the nitrogen atom, forming an N-hydroxy derivative. The potassium salt form indicates that the compound is neutralized with potassium, enhancing its solubility in aqueous environments. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in water due to the ionic nature of the potassium salt. It may be used in various applications, including as a reagent in organic synthesis or as a potential pharmaceutical intermediate. The presence of the N-hydroxy group can impart unique reactivity, making it useful in specific chemical reactions. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would depend on further studies. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H7NO2·K
InChI:InChI=1S/C7H7NO2.K/c9-7(8-10)6-4-2-1-3-5-6;/h1-5,10H,(H,8,9);
InChI key:InChIKey=PUSCQQKPEYGPTB-UHFFFAOYSA-N
SMILES:C(NO)(=O)C1=CC=CC=C1.[K]
Synonyms:- Benzamide, N-hydroxy-, monopotassium salt
- Benzamide, N-hydroxy-, potassium salt (1:1)
- Benzohydroxamic acid, monopotassium salt
- Benzohydroxamic acid, potassium salt
- N-Hydroxybenzamide potassium salt
- Nsc 140755
- Potassium (Benzoylamino)Oxidanide
- Potassium benzohydroxamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Benzohydroxamic acid potassium
CAS:<p>Benzohydroxamic acid potassium salt is an organic compound that is soluble in water, but insoluble in organic solvents. It has a molecular weight of 134.2, and its chemical formula is C7H6N4O3K. It can react with acid solutions to form hydroxamic acids (e.g., benzohydroxamic acid). The nmr spectra of these compounds have been shown to be sensitive to the presence of molybdenum or other metal ions. Benzohydroxamic acid potassium salt can be synthesized by reacting hydrochloric acid with zirconium tetrachloride and carbon tetrachloride in the presence of ethyl bromoacetate. This reaction produces insoluble benzohydroxamic acid potassium salt together with ethyl bromoacetate as a byproduct.<br>Molecular weight: 134.2<br>Chemical formula: C7H6N4O3K<br>Soluble</p>Formula:C7H7NO2•KPurity:Min. 95%Color and Shape:PowderMolecular weight:176.23 g/mol
