CAS 326879-12-3

Benzene,1-fluoro-4-(1-methylenepropyl)-

Description:

Benzene, 1-fluoro-4-(1-methylenepropyl)-, also known by its CAS number 326879-12-3, is an organic compound characterized by a benzene ring substituted with a fluorine atom and a 1-methylenepropyl group. This compound features a hydrophobic aromatic structure, which contributes to its stability and unique chemical properties. The presence of the fluorine atom enhances its reactivity and can influence its interaction with other chemical species, making it of interest in various chemical synthesis and industrial applications. The 1-methylenepropyl group introduces a branched alkyl chain, which can affect the compound's physical properties, such as boiling and melting points, as well as its solubility in different solvents. Additionally, the compound may exhibit specific biological activities, making it relevant in fields such as pharmaceuticals and agrochemicals. Safety and handling precautions are essential due to the potential toxicity associated with fluorinated compounds. Overall, this substance exemplifies the diverse chemistry of substituted aromatic compounds.

Formula: C₁₀H₁₁F

InChI: InChI=1S/C10H11F/c1-3-8(2)9-4-6-10(11)7-5-9/h4-7H,2-3H2,1H3

InChI key: JXOPGWYSORRJHS-UHFFFAOYSA-N

SMILES: CCC(=C)C1=CC=C(C=C1)F

Synonyms:

• Benzene, 1-fluoro-4-(1-methylenepropyl)- (9CI)