CAS 326898-20-8

Benzenamine,N-3-buten-1-yl-3-fluoro-

Description:

Benzenamine, N-3-buten-1-yl-3-fluoro- is an organic compound characterized by its aromatic amine structure, which features a benzene ring attached to an amine group. The presence of a butenyl group indicates a vinyl-like structure, contributing to its reactivity and potential applications in organic synthesis. The fluorine atom introduces unique properties, such as increased electronegativity and potential for enhanced lipophilicity, which can influence the compound's behavior in biological systems and chemical reactions. This compound may exhibit characteristics typical of both amines and alkenes, including basicity due to the amine group and potential for addition reactions due to the double bond in the butenyl group. Its specific applications could range from intermediates in pharmaceuticals to materials science, depending on its reactivity and stability. As with many fluorinated compounds, it may also display unique solubility and volatility characteristics, making it of interest in various fields of research and industry. Safety and handling precautions should be observed due to the potential toxicity associated with amines and fluorinated compounds.

Formula: C₁₀H₁₂FN

InChI: InChI=1S/C10H12FN/c1-2-3-7-12-10-6-4-5-9(11)8-10/h2,4-6,8,12H,1,3,7H2

InChI key: IFMXBJAWXJVUCH-UHFFFAOYSA-N

SMILES: C=CCCNC1=CC(=CC=C1)F

Synonyms:

• Benzenamine,N-3-butenyl-3-fluoro- (9CI)