CAS 32694-82-9
:beta-D-galactopyranosyl-(1->3)-beta-D-galactopyranosyl-(1->4)-D-glucose
Description:
Beta-D-galactopyranosyl-(1->3)-beta-D-galactopyranosyl-(1->4)-D-glucose, commonly referred to as a type of oligosaccharide, is a carbohydrate composed of multiple sugar units. This compound features a backbone of D-glucose and D-galactose units linked through specific glycosidic bonds, which are characterized by their stereochemistry and linkage positions. The presence of beta configurations indicates that the hydroxyl groups on the anomeric carbons are oriented upwards in the Haworth projection. This oligosaccharide is typically soluble in water and may exhibit sweet taste characteristics, depending on its concentration and structural arrangement. It plays a role in various biological processes, including cell recognition and signaling, and can be found in certain plant and microbial polysaccharides. Its structural complexity contributes to its functional properties, making it of interest in food science, nutrition, and biochemistry. Additionally, it may have implications in health-related studies, particularly concerning prebiotic effects and gut microbiota interactions.
Formula:C18H32O16
InChI:InChI=1/C18H32O16/c19-1-5(23)9(25)15(6(24)2-20)33-18-14(30)16(11(27)8(4-22)32-18)34-17-13(29)12(28)10(26)7(3-21)31-17/h1,5-18,20-30H,2-4H2/t5-,6+,7+,8+,9+,10-,11-,12-,13+,14+,15+,16-,17-,18-/m0/s1
InChI key:InChIKey=KZZUYHVLNLDKLB-KZCWKWOXSA-N
SMILES:O([C@@H]1[C@@H](O)[C@H](O[C@@H]([C@@H]([C@H](C=O)O)O)[C@@H](CO)O)O[C@H](CO)[C@@H]1O)[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O
Synonyms:- 32694-82-9
- 3′-Galactosyllactose
- <span class="text-smallcaps">D</smallcap>-Glucose, O-β-<smallcap>D</smallcap>-galactopyranosyl-(1→3)-O-β-<smallcap>D</span>-galactopyranosyl-(1→4)-
- O-β-<span class="text-smallcaps">D</smallcap>-Galactopyranosyl-(1→3)-O-β-<smallcap>D</smallcap>-galactopyranosyl-(1→4)-<smallcap>D</span>-glucose
- O-β-D-Galactopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-D-glucose
- D-Glucose, O-β-D-galactopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-
- (2R,3R,4R,5R)-4-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanal
- 3'-Galactosyl-lactose/Isoglobotriaose(iGb3)(α1-3)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3'-(D-[UL-13C6]Galactosyl)lactose
CAS:Galactosyllactose attenuated NF-κB inflammatory signaling in human intestinal epithelial cells and in human immature intestine. Thus, galactosyllactoses are strong anti-inflammatory agents in human colostrum and early milk, contributing to innate immune modulation. This product has a 13C heavy-label and so can be used in applications such as metabolic tracing and quantitative mass spectrometry.
Formula:C6C12H32O16Purity:Min. 90 Area-%Color and Shape:PowderMolecular weight:510.46 g/mol3'-Galactosyllactose
CAS:Galactosyllactose attenuated NF-κB inflammatory signaling in human intestinal epithelial cells and in human immature intestine. Thus, galactosyllactoses are strong anti-inflammatory agents in human colostrum and early milk, contributing to innate immune modulation. The potential clinical utility of galactosyllactose warrants investigation.Formula:C18H32O16Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:504.44 g/mol3'-Galactosyllactose
CAS:Controlled ProductFormula:C18H32O16Color and Shape:NeatMolecular weight:504.437

