CAS 327021-85-2

Cyclopent[b]indole, 8-chloro-1,2,3,4-tetrahydro-

Description:

Cyclopent[b]indole, 8-chloro-1,2,3,4-tetrahydro- is a chemical compound characterized by its bicyclic structure, which includes a cyclopentane ring fused to an indole moiety. The presence of a chlorine atom at the 8-position of the indole structure contributes to its unique reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen in the indole ring. Its tetrahydro form indicates that it has undergone partial hydrogenation, resulting in a saturated structure that may influence its physical and chemical properties, such as solubility and stability. Cyclopent[b]indole derivatives are of interest in medicinal chemistry for their potential applications in drug development, particularly in the fields of oncology and neurology. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is studied. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₁H₁₀ClN

InChI: InChI=1S/C11H10ClN/c12-8-4-2-6-10-11(8)7-3-1-5-9(7)13-10/h2,4,6,13H,1,3,5H2

InChI key: RGSVMDSYSCJZCE-UHFFFAOYSA-N

SMILES: C1CC2=C(C1)NC3=C2C(=CC=C3)Cl