CAS 327021-89-6

1,2,3,4-Tetrahydro-6-methoxycyclopent[b]indole

Description:

1,2,3,4-Tetrahydro-6-methoxycyclopent[b]indole is a chemical compound characterized by its bicyclic structure, which includes a cyclopentane ring fused to an indole moiety. This compound features a methoxy group (-OCH3) at the 6-position of the indole, contributing to its unique chemical properties. It is typically classified as an indole derivative, which is significant in various biological activities and medicinal chemistry. The tetrahydro configuration indicates that the compound is saturated, which can influence its reactivity and interaction with biological targets. The presence of the methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetics and bioavailability. This compound may exhibit various biological activities, including potential neuropharmacological effects, making it of interest in research related to central nervous system disorders. As with many indole derivatives, it may also serve as a scaffold for the development of novel therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₃NO

InChI: InChI=1S/C12H13NO/c1-14-8-5-6-10-9-3-2-4-11(9)13-12(10)7-8/h5-7,13H,2-4H2,1H3

InChI key: InChIKey=VSAFAJXSNSESEN-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(C3=C(N2)CCC3)=CC1

Synonyms:

• Cyclopent[b]indole, 1,2,3,4-tetrahydro-6-methoxy-
• 1,2,3,4-Tetrahydro-6-methoxycyclopent[b]indole