CAS 327024-81-7

1H-Pyrrole-1-acetic acid,3-(ethoxycarbonyl)-2-methyl-5-(4-methylphenyl)-

Description:

1H-Pyrrole-1-acetic acid, 3-(ethoxycarbonyl)-2-methyl-5-(4-methylphenyl)-, identified by its CAS number 327024-81-7, is a chemical compound that features a pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. This compound exhibits characteristics typical of pyrrole derivatives, including potential biological activity due to the presence of the pyrrole moiety. The ethoxycarbonyl and acetic acid functional groups contribute to its reactivity and solubility in various solvents, making it suitable for applications in organic synthesis and medicinal chemistry. The presence of the 4-methylphenyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. Additionally, the compound's structure suggests potential interactions with biological targets, making it of interest in drug development. Overall, this compound exemplifies the diverse chemistry of pyrrole derivatives, with implications in both synthetic and applied chemistry contexts.

Formula: C₁₇H₁₉NO₄

InChI: InChI=1S/C17H19NO4/c1-4-22-17(21)14-9-15(13-7-5-11(2)6-8-13)18(12(14)3)10-16(19)20/h5-9H,4,10H2,1-3H3,(H,19,20)

InChI key: RWBMERUHQJNIIS-UHFFFAOYSA-N

SMILES: CCOC(=O)C1=C(N(C(=C1)C2=CC=C(C=C2)C)CC(=O)O)C