CAS 327027-21-4
:1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-D-xylofuranose
Description:
1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-D-xylofuranose is a synthetic carbohydrate derivative characterized by its furanose ring structure, which is a five-membered cyclic form of sugar. This compound features multiple acetyl and benzoyl functional groups, which contribute to its chemical reactivity and solubility properties. The presence of the acetyl groups indicates that it can undergo hydrolysis under certain conditions, releasing acetic acid and potentially altering its biological activity. The benzoyl group enhances the lipophilicity of the molecule, making it more soluble in organic solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex carbohydrate derivatives or pharmaceuticals. Its structural modifications can influence its interaction with biological systems, making it of interest in medicinal chemistry and glycoscience. As with many carbohydrate derivatives, it may exhibit specific stereochemical configurations that are crucial for its biological function and reactivity.
Formula:C16H18O7
InChI:InChI=1/C16H18O7/c1-10(17)21-13-8-15(22-11(2)18)23-14(13)9-20-16(19)12-6-4-3-5-7-12/h3-7,13-15H,8-9H2,1-2H3/t13-,14-,15?/m0/s1
SMILES:CC(=O)O[C@H]1CC(OC(=O)C)O[C@H]1COC(=O)c1ccccc1
Synonyms:- 1,3-di-O-acetyl-2-deoxy-5-O-benzoyl-L-erythro-pentofuranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-L-erythro-pentofuranose
CAS:1,3-Di-O-acetyl-2-deoxy-5-O-benzoyl-L-erythro-pentofuranose is a sugar with a complex carbohydrate structure. It is synthesized by the reaction of 1,3:2,4:5,6:7,8:9,10:11,12:13,14:15,16:17,18:19,20:21 and 22 O acetyl groups with 2 deoxyribose moieties. This product can be used in Click chemistry and glycosylization reactions. The CAS number for this product is 327027-21-4.Formula:C16H18O7Purity:Min. 95%Molecular weight:322.31 g/mol1,3-Di-O-acetyl-5-O-benzoyl-2-deoxy-D-xylofuranose
CAS:1,3-Di-O-acetyl-5-O-benzoyl-2-deoxy-D-xylofuranose is a complex carbohydrate that has been custom synthesized. It is a monosaccharide with a methyl group at the C1 position and an acetyl group at the C3 position. The chemical formula for 1,3 Di-O-acetyl 5 O benzoyl 2 deoxy D xylofuranose is C11H21NO6. The molecular weight of 1,3 Di O acetyl 5 O benzoyl 2 deoxy D xylofuranose is 277.27 g/mol. 1,3 Di O acetyl 5 O benzoyl 2 deoxy D xylofuranose may have glycosidic bonds and be used in the synthesis of other carbohydrates or as a reagent in organic chemistry reactions.Formula:C16H18O7Purity:Min. 95%Molecular weight:322.31 g/mol
