CAS 327056-73-5

3-Chloro-5-fluorobenzonitrile

Description:

3-Chloro-5-fluorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a chlorine atom and a fluorine atom, as well as a nitrile group (-C≡N). The presence of these substituents influences its chemical properties, making it a polar compound with potential applications in pharmaceuticals and agrochemicals. The chlorine and fluorine atoms contribute to its reactivity and stability, while the nitrile group can participate in various chemical reactions, such as nucleophilic additions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 3-Chloro-5-fluorobenzonitrile is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₇H₃ClFN

InChI: InChI=1/C7H3ClFN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H

SMILES: c1c(cc(cc1Cl)F)C#N

Synonyms:

• Benzonitrile, 3-chloro-5-fluoro-
• Ncr Cg Ef
• 3-Chloro-5-Fluoro Benzonitrile

3-chloro-5-fluorobenzonitrile

CAS: 327056-73-5

Formula: C₇H₃ClFN

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.5568

Ref: IN-DA003J9A

3-Chloro-5-fluorobenzonitrile

CAS: 327056-73-5

3-Chloro-5-fluorobenzonitrile

Formula: C₇H₃ClFN

Purity: ≥95%

Color and Shape: Pale Yellow Solid

Molecular weight: 155.56g/mol

Ref: 54-PC2904

3-Chloro-5-fluorobenzonitrile

CAS: 327056-73-5

Formula: C₇H₃ClFN

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 155.56

Ref: 10-F033903