CAS 327056-74-6

3-Cyano-5-fluorobenzoic acid

Description:

3-Cyano-5-fluorobenzoic acid is an aromatic compound characterized by the presence of a cyano group (-CN) and a fluorine atom attached to a benzoic acid structure. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, making it soluble in polar solvents. The cyano group contributes to the compound's reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The fluorine atom enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of both electron-withdrawing groups (the cyano and fluorine) can affect the electronic properties of the molecule, potentially altering its reactivity and interaction with biological targets. Overall, 3-Cyano-5-fluorobenzoic acid is a versatile compound with applications in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₈H₄FNO₂

InChI: InChI=1/C8H4FNO2/c9-7-2-5(4-10)1-6(3-7)8(11)12/h1-3H,(H,11,12)

InChI key: InChIKey=HADZSOZVTCEMNP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(C#N)=CC(F)=C1

Synonyms:

• 3-Fluoro-5-cyanobenzoic acid
• Benzoic acid, 3-cyano-5-fluoro-
• 3-Cyano-5-fluorobenzoic acid
• 3-Cyao-5-fluorobenzoic acid
• 3-CYANO-5-FLUOROBENZOIC ACID, 98% MIN.
• 3-Cyano-5-fluorobenzoic acid 98%
• Benzoic acid, 3-cyano-5-fluoro- (9CI)
• 3-Carboxy-5-fluorobenzonitrile

Benzoic acid, 3-cyano-5-fluoro-

CAS: 327056-74-6

Formula: C₈H₄FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.1213

Ref: IN-DA00I687

3-Cyano-5-fluorobenzoic acid

CAS: 327056-74-6

3-Cyano-5-fluorobenzoic acid

Purity: 95%

Color and Shape: White-Pale Yellow Powder

Molecular weight: 165.12g/mol

Ref: 54-PC3859

3-Cyano-5-fluorobenzoic acid

CAS: 327056-74-6

Formula: C₈H₄FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.123

Ref: 10-F013901