CAS 32725-29-4

2,3,5,10-tetrahydroimidazo[2,1-b]quinazoline

Description:

2,3,5,10-tetrahydroimidazo[2,1-b]quinazoline is a bicyclic compound characterized by its fused imidazole and quinazoline rings. This substance typically exhibits a molecular structure that contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is generally a colorless to pale yellow solid, and its solubility can vary depending on the solvent used, often being more soluble in polar organic solvents. It may possess basic properties due to the nitrogen atoms in its structure, which can participate in hydrogen bonding and coordination with metal ions. The compound's unique ring system may confer specific pharmacological properties, making it a candidate for research in areas such as drug development, particularly in targeting certain biological pathways. Additionally, its stability and reactivity can be influenced by the presence of substituents on the ring structure, which can modify its interaction with biological targets. Overall, 2,3,5,10-tetrahydroimidazo[2,1-b]quinazoline represents a class of compounds with potential therapeutic applications.

Formula: C₁₀H₁₁N₃

InChI: InChI=1/C10H11N3/c1-2-4-9-8(3-1)7-13-6-5-11-10(13)12-9/h1-4H,5-7H2,(H,11,12)

SMILES: c1ccc2c(c1)CN1CCN=C1N2

Synonyms:

• 1,2,3,5-Tetrahydroimidazo[2,1-b]quinazoline
• Imidazo[2,1-B]Quinazoline, 1,2,3,5-Tetrahydro-

1H,2H,3H,5H-Imidazolidino[2,1-b]quinazoline

CAS: 32725-29-4

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃

Purity: Min. 95%

Molecular weight: 173.21 g/mol

Ref: 3D-HBA72529