CAS 32728-78-2

Heliosupine

Description:

Heliosupine, with the CAS number 32728-78-2, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from natural sources, particularly certain plant species. Heliosupine is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and analgesic effects. Additionally, it may exhibit interactions with various biological targets, making it a subject of research for therapeutic applications. However, detailed studies on its mechanism of action, toxicity, and efficacy are essential for understanding its full potential. As with many alkaloids, the extraction and purification processes are critical for obtaining Heliosupine in a usable form for research or pharmaceutical development. Overall, while Heliosupine shows promise, further investigation is necessary to fully elucidate its characteristics and applications in medicine.

Formula: C₂₀H₃₁NO₇

InChI: InChI=1S/C20H31NO7/c1-6-12(2)17(23)28-15-8-10-21-9-7-14(16(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6-7,13,15-16,22,25-26H,8-11H2,1-5H3/b12-6-/t13-,15-,16+,20+/m0/s1

InChI key: InChIKey=HRSGCYGUWHGOPY-UKLMUADPSA-N

SMILES: C(OC([C@@](C(C)(C)O)([C@H](C)O)O)=O)C=1[C@]2(N(CC[C@@H]2OC(/C(=C\C)/C)=O)CC1)[H]

Synonyms:

• D-erythro-Pentitol, 1,5-dideoxy-4-C-methyl-3-C-[[[(1S,7aR)-2,3,5,7a-tetrahydro-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-7-yl]methoxy]carbonyl]-
• Heliosupine
• D-erythro-Pentitol, 1,5-dideoxy-4-C-methyl-3-C-[[[(1S,7aR)-2,3,5,7a-tetrahydro-1-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-1H-pyrrolizin-7-yl]methoxy]carbonyl]-
• 1,5-Dideoxy-4-C-methyl-3-C-[[[(1S,7aR)-2,3,5,7a-tetrahydro-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-7-yl]methoxy]carbonyl]-D-erythro-pentitol
• 2-Butenoic acid, 2-methyl-, 7-[[2,3-dihydroxy-2-(1-hydroxyethyl)-3-methyl-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl ester, [1S-[1α(Z),7[R*(R*)],7aα]]-

Heliosupine sulfate

CAS: 32728-78-2

Natural alkaloid

Formula: C₂₀H₃₁NO₇·5H₂SO₄

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 446.5

Ref: 5G-86678

Heliosupine

CAS: 32728-78-2

Heliosupine is a novel bioactive compound, which is a synthesized derivative originating from naturally occurring alkaloids. Its mode of action involves the modulation of specific cellular signaling pathways that are crucial for cell proliferation and apoptosis. By influencing these pathways, Heliosupine has shown promise in regulating abnormal cellular processes, providing a potential therapeutic avenue for diseases characterized by uncontrolled cell growth.

Formula: C₂₀H₃₁NO₇

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 397.5 g/mol

Ref: 3D-XH180148

Heliosupine

CAS: 32728-78-2

Formula: C₂₀H₃₁NO₇

Molecular weight: 397.47

Ref: 4Z-H-078001