CAS 3273-44-7

5-methyl-1H-pyrazole-3-carbaldehyde

Description:

5-Methyl-1H-pyrazole-3-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group at the 5-position and an aldehyde functional group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the aldehyde group makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 5-methyl-1H-pyrazole-3-carbaldehyde can participate in various chemical reactions, including condensation and nucleophilic addition, due to the electrophilic nature of the carbonyl carbon. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of compounds with biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₆N₂O

InChI: InChI=1/C5H6N2O/c1-4-2-5(3-8)7-6-4/h2-3H,1H3,(H,6,7)

SMILES: Cc1cc(C=O)n[nH]1

Synonyms:

• 1H-pyrazole-3-carboxaldehyde, 5-methyl-
• 1H-Pyrazole-5-carboxaldehyde, 3-methyl-
• 3-Methyl-1H-pyrazole-5-carbaldehyde
• 5-Methyl-2H-pyrazole-3-carbaldehyde

5-Methyl-1H-pyrazole-3-carbaldehyde

CAS: 3273-44-7

Formula: C₅H₆N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 110.1139

Ref: IN-DA0034AO

5-Methyl-1H-pyrazole-3-carbaldehyde

CAS: 3273-44-7

5-Methyl-1H-pyrazole-3-carbaldehyde

Purity: 98%

Molecular weight: 110.11g/mol

Ref: 54-OR925890

3-Methyl-1H-pyrazole-5-carbaldehyde

CAS: 3273-44-7

Formula: C₅H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 110.116

Ref: 10-F031334