CAS 3273-78-7
:4,4'-oxybis(2-nitroaniline)
Description:
4,4'-Oxybis(2-nitroaniline), with the CAS number 3273-78-7, is an organic compound characterized by its structure, which features two 2-nitroaniline groups connected by an ether linkage (the -O- group). This compound typically appears as a solid and is known for its yellow to orange color due to the presence of nitro groups, which are electron-withdrawing and contribute to its chromophoric properties. It is primarily used in the synthesis of dyes and pigments, as well as in various chemical applications due to its ability to undergo further chemical transformations. The presence of nitro groups also imparts certain reactivity, making it a potential candidate for use in materials science and organic synthesis. Additionally, 4,4'-oxybis(2-nitroaniline) may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. Its solubility characteristics can vary, often being more soluble in organic solvents than in water.
Formula:C12H10N4O5
InChI:InChI=1/C12H10N4O5/c13-9-3-1-7(5-11(9)15(17)18)21-8-2-4-10(14)12(6-8)16(19)20/h1-6H,13-14H2
SMILES:c1cc(c(cc1Oc1ccc(c(c1)N(=O)=O)N)N(=O)=O)N
Synonyms:- Benzenamine, 4,4'-Oxybis[2-Nitro-
- 4,4'-Oxybis(2-nitroaniline)
- [4-(4-amino-3-nitro-phenoxy)-2-nitro-phenyl]amine
- 4,4'-DIAMINO-3,3'-DINITRODIPHENYL ETHER
- 4-(4-amino-3-nitrophenoxy)-2-nitroaniline
- 4-(4-azanyl-3-nitro-phenoxy)-2-nitro-aniline
- Bis-(4-amino-3-nitrophenyl)-ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
