CymitQuimica logo

CAS 3275-44-3

:

5-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine

Description:
5-(4-Chlorophenyl)-6-methylpyrimidine-2,4-diamine, with the CAS number 3275-44-3, is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a 4-chlorophenyl group and a methyl group at specific positions on the pyrimidine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of amino groups that can engage in hydrogen bonding. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, which may include antimicrobial or anticancer properties. Its structure allows for various chemical modifications, making it a versatile scaffold in drug development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Proper storage conditions are also essential to maintain its stability and integrity.
Formula:C11H11ClN4
InChI:InChI=1/C11H11ClN4/c1-6-9(10(13)16-11(14)15-6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H4,13,14,15,16)
SMILES:Cc1c(c2ccc(cc2)Cl)c(=N)[nH]c(=N)[nH]1
Synonyms:
  • 2,4-Pyrimidinediamine, 5-(4-Chlorophenyl)-6-Methyl-
  • Tcmdc-138984
  • 5-(4-Chlorophenyl)-6-methylpyrimidine-2,4-diamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.