CAS 32769-01-0

Tricin 7-O-β-D-glucopyranoside

Description:

Tricin 7-O-β-D-glucopyranoside is a flavonoid glycoside, primarily derived from various plant sources, particularly in the Poaceae family, such as rice and other grasses. This compound features a tricin backbone, which is a flavone, linked to a glucose moiety at the 7-position through a glycosidic bond. The presence of the glucopyranoside group enhances its solubility in water and may influence its biological activity. Tricin and its derivatives are known for their antioxidant properties, which can contribute to various health benefits, including anti-inflammatory and potential anticancer effects. Additionally, tricin glycosides are studied for their role in plant defense mechanisms and their potential applications in food and pharmaceutical industries due to their bioactive properties. The compound is typically characterized by its molecular formula, which reflects the number of carbon, hydrogen, and oxygen atoms, and its structure can be elucidated using techniques such as NMR and mass spectrometry. Overall, Tricin 7-O-β-D-glucopyranoside represents a significant area of interest in phytochemistry and natural product research.

Formula: C₂₁H₂₀O₁₀

InChI: InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)13-7-12(26)18-11(25)5-10(6-14(18)34-13)33-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3/t17-,20-,21+,22-,23-/m1/s1

InChI key: InChIKey=JGXFMIJHKASCIZ-LDBVRRDLSA-N

SMILES: O=C1C=2C(OC(=C1)C3=CC(OC)=C(O)C(OC)=C3)=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=CC2O

Synonyms:

• 7-(β-D-Glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4H-1-benzopyran-4-one
• Flavone, 4′,5,7-trihydroxy-3′,5′-dimethoxy-, 7-β-D-glucopyranoside
• Tricin 7-O-glucoside
• Tricin 7-glucoside
• 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-
• 2-(4-Hydroxy-3,5-dimethoxyphenyl)-7-(β-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one
• 7-[(β-D-Glucopyranosyl)oxy]-4',5-dihydroxy-3',5'-dimethoxyflavone
• 3',5'-Dimethoxytricetin 7-O-β-D-glucopypranoside

3',5'-Dimethoxytricetin 7-O-β-D-glucopypranoside

CAS: 32769-01-0

Formula: C₂₃H₂₄O₁₂

Molecular weight: 492.4295

Ref: IN-DA00CV79

5-Hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-one

CAS: 32769-01-0

5-Hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-one

Purity: 98%

Molecular weight: 492.43g/mol

Ref: 54-OR1062982

Tricin 7-O-glucoside

CAS: 32769-01-0

Tricin 7-O-glucoside is a natural flavonoid antidepressant and anxiolytic,attenuating brain I/R damage , decreasing HMGB1 and NF-κB signaling pathways.

Formula: C₂₃H₂₄O₁₂

Color and Shape: Solid

Molecular weight: 492.43

Ref: TM-TN5547

Tricine 7-Glucoside

Controlled Product

CAS: 32769-01-0

Formula: C₂₃H₂₄O₁₂

Color and Shape: Neat

Molecular weight: 492.43

Ref: TR-T327690

Tricin 7-o-glucoside

CAS: 32769-01-0

Tricin 7-o-glucoside is a flavonoid glycoside, which is a naturally occurring compound found in various plants. It is sourced from diverse botanical species, including certain grasses and cereals, where it plays a role in the plant's defense mechanisms. The compound consists of the flavone tricin linked to a glucose molecule, contributing to its stability and solubility.

Formula: C₂₃H₂₄O₁₂

Purity: Min. 95%

Molecular weight: 492.4 g/mol

Ref: 3D-HBA76901