CAS 3277-80-3

(4-chlorophenyl)(cyclohexyl)methanone

Description:

(4-chlorophenyl)(cyclohexyl)methanone, with the CAS number 3277-80-3, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the carbonyl group (C=O) attached to a cyclohexyl and a para-chlorophenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic cyclohexyl ring. The presence of the chlorine atom on the phenyl ring can influence its reactivity and polarity, making it a useful intermediate in organic synthesis and pharmaceuticals. Additionally, the compound may exhibit biological activity, which can be explored in various chemical and medicinal research contexts. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₁₃H₁₅ClO

InChI: InChI=1/C13H15ClO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h6-10H,1-5H2

SMILES: C1CCC(CC1)C(=O)c1ccc(cc1)Cl

Synonyms:

• Methanone, (4-Chlorophenyl)Cyclohexyl-

(4-Chlorophenyl)(cyclohexyl)methanone

CAS: 3277-80-3

(4-Chlorophenyl)(cyclohexyl)methanone

Purity: 95%

Molecular weight: 222.71g/mol

Ref: 54-OR86535

4-Chlorophenyl cyclohexyl ketone

CAS: 3277-80-3

Formula: C₁₃H₁₅ClO

Purity: 97.0%

Molecular weight: 222.71

Ref: 10-F204170

4-Chlorophenyl cyclohexyl ketone

CAS: 3277-80-3

Versatile small molecule scaffold

Formula: C₁₃H₁₅ClO

Purity: Min. 95%

Molecular weight: 222.71 g/mol

Ref: 3D-DAA27780