CAS 32779-36-5
:5-Bromo-2-chloropyrimidine
Description:
5-Bromo-2-chloropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with both bromine and chlorine atoms. The presence of these halogen substituents at the 5 and 2 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. The compound exhibits moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its unique structure allows it to participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, 5-bromo-2-chloropyrimidine can serve as a building block for the development of biologically active molecules, highlighting its significance in medicinal chemistry.
Formula:C4H2N2BrCl
InChI:InChI=1/C4H2BrClN2/c5-3-1-7-4(6)8-2-3/h1-2H
SMILES:c1c(cnc(Cl)n1)Br
Synonyms:- 2-Chloro-5-Bromopyrimidine
- Pyrimidine, 5-bromo-2-chloro-
- Majorimpurityis
- 2C5Bp
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
5-Bromo-2-chloropyrimidine
CAS:Formula:C4H2BrClN2Purity:>97.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:193.435-Bromo-2-chloropyrimidine, 98+%
CAS:It is applied as a pharmaceutical intermediate, in the synthesis of pharmaceutical goods such as inhibitors. It is also employed in the cross-coupling reactions of indium organometallics with 2,5-dihalopyrimidines. This Thermo Scientific Chemicals brand product was originally part of the Alfa AesarFormula:C4H2BrClN2Purity:98+%Color and Shape:Crystals or crystalline powder, White to creamMolecular weight:193.435-Bromo-2-chloropyrimidine
CAS:Formula:C4H2BrClN2Purity:98%Color and Shape:SolidMolecular weight:193.4291Ref: IN-DA00347L
5kgTo inquire1g22.00€5g22.00€25g25.00€10g26.00€50g47.00€100g68.00€250g132.00€500g184.00€1kg243.00€5-Bromo-2-chloropyrimidine
CAS:5-Bromo-2-chloropyrimidineFormula:C4H2BrClN2Purity:98%Color and Shape: light yellow solidMolecular weight:193.43g/mol5-Bromo-2-chloropyrimidine
CAS:Formula:C4H2BrClN2Purity:98.0%Color and Shape:Solid, Crystalline PowderMolecular weight:193.435-Bromo-2-chloropyrimidine
CAS:Intermediate in the synthesis of macitentan; building blockFormula:C4H2BrClN2Purity:Min. 95%Color and Shape:White PowderMolecular weight:193.43 g/mol5-Bromo-2-chloropyrimidine
CAS:Controlled ProductStability Hygroscopic
Applications 5-Bromo-2-chloropyrimidine is an intermediate in the synthesis of pharmaceutical goods such as inhibitors.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Venier, O., et al.: Bioorg. Med. Chem. Lett., 23, 2414 (2013); Zhang, Z.H., et al.: J. Med. Chem., 56, 568 (2013);Formula:C4H2BrClN2Color and Shape:NeatMolecular weight:193.435-Bromo-2-chloropyrimidine-15N2
CAS:Controlled ProductFormula:C4H2BrCl15N2Color and Shape:NeatMolecular weight:195.416










