CAS 32785-92-5
:1-deoxy-D-fructose
Description:
1-Deoxy-D-fructose is a monosaccharide and a derivative of fructose, characterized by the absence of a hydroxyl group at the C-1 position. This structural modification influences its reactivity and biological properties. It typically appears as a white to off-white crystalline powder and is soluble in water, making it suitable for various applications in biochemistry and food science. The molecular formula of 1-deoxy-D-fructose is C6H12O5, and it has a molecular weight that reflects its composition of carbon, hydrogen, and oxygen atoms. This compound is of interest due to its potential role in metabolic pathways and its use as a sweetener or sugar substitute in food products. Additionally, it may exhibit different sweetness levels compared to its parent compound, fructose, and can participate in Maillard reactions, influencing flavor and color in food processing. Overall, 1-deoxy-D-fructose serves as a valuable compound in both research and industrial applications.
Formula:C6H12O5
InChI:InChI=1/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h4-7,9-11H,2H2,1H3/t4-,5-,6-/m1/s1
SMILES:CC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O
Synonyms:- D-fructose, 1-deoxy-
- 1-Deoxy-D-fructose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Deoxy-D-fructose
CAS:Formula:C6H12O5Purity:≥ 97.0%Color and Shape:Colourless syrupMolecular weight:164.161-Deoxy-D-fructose
CAS:1-Deoxy-D-fructose is a sugar that is found in plants. It has been shown to stimulate insulin release from the pancreas and regulate glucose levels. 1-Deoxy-D-fructose has been used as a pharmaceutical preparation for the treatment of diabetes mellitus. 1-Deoxy-D-fructose is not metabolized by cells, but is taken up by cells and reacts with reactive oxygen species (ROS) to produce hydrogen peroxide. This reaction may be responsible for the biological effects of 1-deoxy-d-fructose.Formula:C6H12O5Purity:Min. 97%Color and Shape:Colorless Clear LiquidMolecular weight:164.16 g/mol


