CymitQuimica logo

CAS 32785-93-6

:

1-Chloro-1-deoxy-D-fructose

Description:
1-Chloro-1-deoxy-D-fructose is a halogenated sugar derivative, specifically a modified form of fructose where a chlorine atom replaces a hydroxyl group at the first carbon position. This compound is characterized by its molecular structure, which retains the basic framework of fructose while introducing a chlorine atom, influencing its reactivity and solubility. It is typically a white to off-white crystalline solid, soluble in water due to the presence of other hydroxyl groups in its structure. The substitution of a chlorine atom can affect its biological activity, making it of interest in various fields, including medicinal chemistry and carbohydrate chemistry. The compound may exhibit unique properties such as altered sweetness, stability, and potential applications in synthetic pathways or as a biochemical probe. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact. Overall, 1-Chloro-1-deoxy-D-fructose represents a fascinating example of how small structural modifications can lead to significant changes in chemical behavior and application.
Formula:C6H11ClO5
InChI:InChI=1S/C6H11ClO5/c7-1-3(9)5(11)6(12)4(10)2-8/h4-6,8,10-12H,1-2H2/t4-,5-,6-/m1/s1
InChI key:InChIKey=VBGLFNMWEMGFTR-HSUXUTPPSA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)(C(CCl)=O)O
Synonyms:
  • 1-Chloro-1-deoxy-<span class="text-smallcaps">D</span>-fructose
  • 1-Chloro-1-deoxy-D-fructose
  • <span class="text-smallcaps">D</span>-Fructose, 1-chloro-1-deoxy-
  • Fructose, 1-chloro-1-deoxy-, <span class="text-smallcaps">D</span>-
  • Fructose,1-chloro-1-deoxy-, D- (8CI)
  • Fructose, 1-chloro-1-deoxy-, D-
  • D-Fructose, 1-chloro-1-deoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.