CAS 328-48-3
:4,5-Diamino-5-oxopentanoic acid
Description:
4,5-Diamino-5-oxopentanoic acid, also known as DAPA, is an amino acid derivative characterized by the presence of two amino groups and a keto group within its structure. This compound features a pentanoic acid backbone, which contributes to its classification as an α-amino acid. The presence of the two amino groups at the 4 and 5 positions allows for potential interactions in biological systems, making it of interest in biochemical research, particularly in the context of protein synthesis and metabolic pathways. DAPA is typically a white to off-white crystalline solid, soluble in water due to its polar functional groups. Its molecular structure enables it to participate in various chemical reactions, including those involving amine and carboxylic acid functionalities. Additionally, it may serve as a precursor in the synthesis of other biologically relevant compounds. As with many amino acids, its properties can be influenced by pH and temperature, affecting its solubility and reactivity in different environments.
Formula:C5H10N2O3
InChI:InChI=1S/C5H10N2O3/c6-3(5(7)10)1-2-4(8)9/h3H,1-2,6H2,(H2,7,10)(H,8,9)
InChI key:InChIKey=AEFLONBTGZFSGQ-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(C(N)=O)N
Synonyms:- (?à)-4-Aminoglutaramic acid
- (±)-4-Aminoglutaramic acid
- 4,5-Diamino-5-oxopentanoic acid
- <span class="text-smallcaps">DL</span>-Isoglutamine
- DL-Isoglutamine
- Glutaramic acid, 4-amino-
- Glutaramicacid, 4-amino- (6CI,7CI,8CI)
- Isoglutamine
- a-Glutamine
- Pentanoic acid, 4,5-diamino-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
