CAS 328-67-6
:3-Bromo-5-(trifluoromethyl)benzoic acid
Description:
3-Bromo-5-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzene ring. The bromine substituent is located at the meta position relative to the carboxylic acid group, while the trifluoromethyl group is positioned at the para position. This compound is typically a white to off-white solid at room temperature and is known for its relatively high melting point. It is soluble in organic solvents such as acetone and dichloromethane but has limited solubility in water due to the hydrophobic nature of the trifluoromethyl group. The presence of both bromine and trifluoromethyl groups contributes to its unique chemical reactivity, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. Additionally, the compound exhibits potential biological activity, which may be explored in medicinal chemistry. Proper handling and safety precautions are essential due to its potential toxicity and environmental impact.
Formula:C8H4BrF3O2
InChI:InChI=1/C8H4BrF3O2/c9-6-2-4(7(13)14)1-5(3-6)8(10,11)12/h1-3H,(H,13,14)
SMILES:c1c(cc(cc1C(F)(F)F)Br)C(=O)O
Synonyms:- Bromotrifluoromethylbenzoic acid
- Benzoic acid, 3-bromo-5-(trifluoromethyl)-
- 3-Bromo-5-trifluoromethyl-benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 3-bromo-5-(trifluoromethyl)-
CAS:Formula:C8H4BrF3O2Purity:98%Color and Shape:SolidMolecular weight:269.01543-Bromo-5-(trifluoromethyl)benzoic Acid
CAS:Formula:C8H4BrF3O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:269.023-Bromo-5-(trifluoromethyl)benzoic acid
CAS:3-Bromo-5-(trifluoromethyl)benzoic acidFormula:C8H4BrF3O2Purity:97%Color and Shape: white solidMolecular weight:269.02g/mol3-Bromo-5-(trifluoromethyl)benzoic acid
CAS:Formula:C8H4BrF3O2Purity:97%Color and Shape:SolidMolecular weight:269.0173-Bromo-5-(trifluoromethyl)benzoic acid
CAS:3-Bromo-5-(trifluoromethyl)benzoic acid is a drug resistant hydroxamic acid that can be used to treat tuberculosis. 3-Bromo-5-(trifluoromethyl)benzoic acid inhibits the growth of Mycobacterium tuberculosis and has been shown to be effective against multi-drug resistant strains of Mycobacterium tuberculosis. 3-Bromo-5-(trifluoromethyl)benzoic acid has also been shown to inhibit the synthesis of proteins by blocking the production of amino acids. The drug blocks protein synthesis by inhibiting an enzyme called hydroxamate methyltransferase, which is responsible for converting N5,N10-methylenetetrahydrofolate into 5,10 methylenetetrahydrofolate (an important cofactor in protein synthesis).
Formula:C8H4BrF3O2Purity:Min. 95%Molecular weight:269.02 g/mol




