CAS 328-79-0

3-Methoxy-5-nitrobenzotrifluoride

Description:

3-Methoxy-5-nitrobenzotrifluoride, with the CAS number 328-79-0, is an aromatic compound characterized by the presence of a methoxy group (-OCH₃), a nitro group (-NO₂), and three fluorine atoms attached to a benzene ring. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its physical state at room temperature. It is known for its relatively high stability and low volatility, making it suitable for various chemical applications. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and interactions with other chemical species. Additionally, the trifluoromethyl groups enhance its lipophilicity, potentially affecting its solubility in organic solvents. 3-Methoxy-5-nitrobenzotrifluoride is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its unique electronic and steric properties. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₈H₆F₃NO₃

InChI: InChI=1S/C8H6F3NO3/c1-15-7-3-5(8(9,10)11)2-6(4-7)12(13)14/h2-4H,1H3

SMILES: COc1cc(cc(c1)N(=O)=O)C(F)(F)F

Synonyms:

• 3-Nitro-5-(trifluoromethyl)anisole

3-Methoxy-5-nitrobenzotrifluoride

CAS: 328-79-0

Formula: C₈H₆F₃NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 221.1333

Ref: IN-DA00BXE0

3-Methoxy-5-nitrobenzotrifluoride

CAS: 328-79-0

3-Methoxy-5-nitrobenzotrifluoride

Formula: C₈H₆F₃NO₃

Purity: 99%

Color and Shape: low-mwlting solid

Molecular weight: 221.13g/mol

Ref: 54-PC5055

3-Methoxy-5-nitrobenzotrifluoride

CAS: 328-79-0

Formula: C₈H₆F₃NO₃

Purity: 98%

Color and Shape: Solid, Brown powder

Molecular weight: 221.135

Ref: 10-F319062