CAS 328028-08-6

2-[[(4-Methyl-3-nitrophenyl)sulfonyl]amino]benzoic acid

Description:

2-[[(4-Methyl-3-nitrophenyl)sulfonyl]amino]benzoic acid, identified by its CAS number 328028-08-6, is a chemical compound characterized by its sulfonamide functional group and an aromatic structure. This compound features a benzoic acid moiety, which contributes to its acidic properties, and a sulfonyl group attached to a nitrophenyl ring, enhancing its potential for biological activity. The presence of the nitro group suggests that it may exhibit electron-withdrawing characteristics, influencing its reactivity and solubility. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure indicates that it may participate in hydrogen bonding due to the carboxylic acid group, which can affect its interactions in biological systems. Additionally, the presence of the methyl group on the phenyl ring may influence its lipophilicity and overall stability. Overall, this compound represents a class of sulfonamide derivatives that may have significant implications in drug development and chemical research.

Formula: C₁₄H₁₂N₂O₆S

InChI: InChI=1S/C14H12N2O6S/c1-9-6-7-10(8-13(9)16(19)20)23(21,22)15-12-5-3-2-4-11(12)14(17)18/h2-8,15H,1H3,(H,17,18)

InChI key: InChIKey=ZOIDZMVEJCJFHW-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC(N(=O)=O)=C(C)C=C1)C2=C(C(O)=O)C=CC=C2

Synonyms:

• 2-[[(4-Methyl-3-nitrophenyl)sulfonyl]amino]benzoic acid
• Benzoic acid, 2-[[(4-methyl-3-nitrophenyl)sulfonyl]amino]-

2-(4-Methyl-3-nitrobenzenesulfonamido)benzoic acid

CAS: 328028-08-6

Versatile small molecule scaffold

Formula: C₁₄H₁₂N₂O₆S

Purity: Min. 95%

Molecular weight: 336.32 g/mol

Ref: 3D-DNA02808