CAS 328028-30-4

5-[[(2-Chloro-5-nitrophenyl)sulfonyl]amino]-2-hydroxybenzoic acid

Description:

5-[[(2-Chloro-5-nitrophenyl)sulfonyl]amino]-2-hydroxybenzoic acid, identified by its CAS number 328028-30-4, is a chemical compound characterized by its complex structure, which includes a hydroxyl group, a sulfonamide linkage, and a nitrophenyl moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. The presence of the chloro and nitro substituents on the phenyl ring contributes to its reactivity and potential biological activity. It is likely to be soluble in polar solvents due to the hydroxyl and sulfonamide groups, while its aromatic structure may provide some degree of hydrophobic character. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its unique functional groups suggest potential applications in medicinal chemistry, where modifications could lead to enhanced efficacy or selectivity in therapeutic contexts.

Formula: C₁₃H₉ClN₂O₇S

InChI: InChI=1S/C13H9ClN2O7S/c14-10-3-2-8(16(20)21)6-12(10)24(22,23)15-7-1-4-11(17)9(5-7)13(18)19/h1-6,15,17H,(H,18,19)

InChI key: InChIKey=KKWHQRWSXVDVOU-UHFFFAOYSA-N

SMILES: S(NC1=CC(C(O)=O)=C(O)C=C1)(=O)(=O)C2=CC(N(=O)=O)=CC=C2Cl

Synonyms:

• 5-[[(2-Chloro-5-nitrophenyl)sulfonyl]amino]-2-hydroxybenzoic acid
• Benzoic acid, 5-[[(2-chloro-5-nitrophenyl)sulfonyl]amino]-2-hydroxy-

5-(2-Chloro-5-nitrobenzenesulfonamido)-2-hydroxybenzoic acid

CAS: 328028-30-4

Versatile small molecule scaffold

Formula: C₁₃H₉ClN₂O₇S

Purity: Min. 95%

Molecular weight: 372.74 g/mol

Ref: 3D-DNA02830