CAS 328083-91-6

4-Piperidinamine, 1-[(3,4-difluorophenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[(3,4-difluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a difluorophenyl group, indicating the presence of two fluorine atoms substituted on a phenyl ring, which can significantly influence its chemical properties and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the amine functional group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions, efficacy, and safety profile would depend on further empirical studies. Overall, the unique structural features of this compound contribute to its potential applications in drug discovery and development.

Formula: C₁₂H₁₆F₂N₂·2ClH

InChI: InChI=1S/C12H16F2N2.2ClH/c13-11-2-1-9(7-12(11)14)8-16-5-3-10(15)4-6-16;;/h1-2,7,10H,3-6,8,15H2;2*1H

InChI key: InChIKey=IOKYHLYDSQRSGF-UHFFFAOYSA-N

SMILES: C(C1=CC(F)=C(F)C=C1)N2CCC(N)CC2.Cl

Synonyms:

• 4-Piperidinamine, 1-[(3,4-difluorophenyl)methyl]-, dihydrochloride
• 1-[(3,4-Difluorophenyl)methyl]piperidin-4-ylamine dihydrochloride
• 4-Piperidinamine, 1-[(3,4-difluorophenyl)methyl]-, hydrochloride (1:2)

1-(3,4-Difluorobenzyl)piperidin-4-aminedihydrochloride

CAS: 328083-91-6

Formula: C₁₂H₁₈Cl₂F₂N₂

Purity: 95.0%

Molecular weight: 299.19

Ref: 10-F064048