CAS 32810-58-5
:Carbamodithioic acid, N,N-dipentyl-, sodium salt (1:1)
Description:
Carbamodithioic acid, N,N-dipentyl-, sodium salt (1:1), with the CAS number 32810-58-5, is a chemical compound that belongs to the class of dithiocarbamates. This substance typically appears as a solid or crystalline material and is characterized by its sodium salt form, which enhances its solubility in water. The presence of the dipentyl groups contributes to its hydrophobic properties, influencing its behavior in various chemical environments. As a dithiocarbamate, it may exhibit fungicidal and herbicidal properties, making it of interest in agricultural applications. The compound's structure includes a central carbon atom bonded to a nitrogen atom and two sulfur atoms, which are key to its reactivity and interaction with other chemicals. Additionally, the sodium salt form can facilitate its use in formulations where ionic compounds are preferred. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity and environmental impact. Overall, this compound's unique characteristics make it valuable in specific industrial and agricultural contexts.
Formula:C11H23NS2·Na
InChI:InChI=1S/C11H23NS2.Na/c1-3-5-7-9-12(11(13)14)10-8-6-4-2;/h3-10H2,1-2H3,(H,13,14);
InChI key:InChIKey=IVJKVKBOPSLCIR-UHFFFAOYSA-N
SMILES:N(CCCCC)(CCCCC)C(=S)S.[Na]
Synonyms:- Carbamodithioic acid, dipentyl-, sodium salt
- Carbamic acid, dipentyldithio-, sodium salt
- Sodium dipentyldithiocarbamate
- Carbamodithioic acid, N,N-dipentyl-, sodium salt (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Sodium dipentylcarbamodithioate
CAS:<p>Sodium dipentylcarbamodithioate is an aliphatic hydrocarbon that is used as a coupling agent in organic synthesis. It has been known to react with molybdenum, forming a product that resembles the structure of fatty acids. Sodium dipentylcarbamodithioate also reacts with glycerin to form an ester. This reaction product is a viscosity modifier and corrosion inhibitor for petroleum products. The functional groups of this compound are dithiocarbamic, which are acidic and react with fatty acids to form salts.</p>Formula:C11H22NNaS2Purity:Min. 95%Molecular weight:255.4 g/mol
