CAS 32811-76-0

Cyclopentanecarboxylic acid, 3-hydroxy-, methyl ester

Description:

Cyclopentanecarboxylic acid, 3-hydroxy-, methyl ester, with the CAS number 32811-76-0, is an organic compound characterized by its cyclopentane ring structure, which is substituted with a carboxylic acid and a hydroxyl group, along with a methyl ester functional group. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the hydroxyl group contributes to its potential for hydrogen bonding, which can influence its boiling point and solubility in polar solvents. Cyclopentanecarboxylic acid derivatives are often studied for their applications in pharmaceuticals and as intermediates in organic synthesis. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can vary depending on the specific conditions and the presence of other functional groups in a given reaction environment. Overall, this compound represents a unique combination of structural features that can lead to diverse chemical behavior and applications.

Formula: C₇H₁₂O₃

InChI: InChI=1S/C7H12O3/c1-10-7(9)5-2-3-6(8)4-5/h5-6,8H,2-4H2,1H3

InChI key: InChIKey=ASZRODBLMORHAR-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1CC(O)CC1

Synonyms:

• Methyl 3-hydroxycyclopentanecarboxylate
• Cyclopentanecarboxylic acid, 3-hydroxy-, methyl ester
• 3-Hydroxycyclopentanecarboxylic acid methyl ester
• Methyl 3-hydroxycyclopentane-1-carboxylate

methyl (1S)-3-hydroxycyclopentane-1-carboxylate

CAS: 32811-76-0

Formula: C₇H₁₂O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 144.1684

Ref: IN-DA00CISP

Methyl 3-hydroxycyclopentanecarboxylate

CAS: 32811-76-0

Methyl 3-hydroxycyclopentanecarboxylate

Purity: 97%

Molecular weight: 144.17g/mol

Ref: 54-OR81422

Methyl 3-hydroxycyclopentanecarboxylate

CAS: 32811-76-0

Formula: C₇H₁₂O₃

Purity: 97%

Molecular weight: 144.17

Ref: 10-F459821

Methyl 3-hydroxycyclopentanecarboxylate

CAS: 32811-76-0

Versatile small molecule scaffold

Formula: C₇H₁₂O₃

Purity: Min. 95%

Molecular weight: 144.17 g/mol

Ref: 3D-HBA81176