CAS 328270-32-2

Alanine, 2-chloro-N-(chloroacetyl)-3,3,3-trifluoro-, ethyl ester

Description:

Alanine, 2-chloro-N-(chloroacetyl)-3,3,3-trifluoro-, ethyl ester is a synthetic compound characterized by its unique structure, which includes an alanine backbone modified with chloroacetyl and trifluoromethyl groups. This compound features a chloro group at the second position of the alanine molecule, contributing to its reactivity and potential applications in organic synthesis. The presence of trifluoromethyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. As an ethyl ester, it possesses an ester functional group that can undergo hydrolysis, making it relevant in various chemical reactions. The compound's CAS number, 328270-32-2, allows for precise identification in chemical databases. Its properties, such as solubility, stability, and reactivity, would be influenced by the presence of halogen atoms and the overall molecular structure, making it a subject of interest for further research in pharmaceuticals and agrochemicals. Safety and handling precautions should be observed due to the presence of chlorine and fluorine atoms, which can pose health risks.

Formula: C₇H₈Cl₂F₃NO₃

InChI: InChI=1S/C7H8Cl2F3NO3/c1-2-16-5(15)6(9,7(10,11)12)13-4(14)3-8/h2-3H2,1H3,(H,13,14)

InChI key: InChIKey=IRSDCYYKDISRRJ-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(NC(CCl)=O)(C(F)(F)F)Cl

Synonyms:

• Alanine, 2-chloro-N-(chloroacetyl)-3,3,3-trifluoro-, ethyl ester

ethyl 2-chloro-2-[(2-chloroacetyl)amino]-3,3,3-trifluoropropanoate

CAS: 328270-32-2

ethyl 2-chloro-2-[(2-chloroacetyl)amino]-3,3,3-trifluoropropanoate

Purity: ≥95%

Molecular weight: 282.04g/mol

Ref: 54-PC32147