CAS 3283-07-6
:N,N,N',N'-Tetra(p-aminophenyl)-p-phenylenediamine
Description:
N,N,N',N'-Tetra(p-aminophenyl)-p-phenylenediamine, with the CAS number 3283-07-6, is an organic compound characterized by its complex molecular structure, which includes multiple amino groups and phenyl rings. This substance is typically a dark-colored solid and is known for its applications in the field of dyes and pigments, particularly in the production of rubber and plastics. Its chemical structure allows for strong intermolecular interactions, contributing to its stability and reactivity. The presence of amino groups makes it a potential candidate for various chemical reactions, including coupling reactions in dye synthesis. Additionally, it exhibits properties such as good thermal stability and resistance to fading, making it suitable for use in high-performance materials. However, due to its chemical nature, it may pose health risks, necessitating careful handling and appropriate safety measures in industrial applications. Overall, N,N,N',N'-Tetra(p-aminophenyl)-p-phenylenediamine is a significant compound in materials science and industrial chemistry.
Formula:C30H28N6
InChI:InChI=1/C30H28N6/c31-21-1-9-25(10-2-21)35(26-11-3-22(32)4-12-26)29-17-19-30(20-18-29)36(27-13-5-23(33)6-14-27)28-15-7-24(34)8-16-28/h1-20H,31-34H2
SMILES:c1cc(ccc1N)N(c1ccc(cc1)N)c1ccc(cc1)N(c1ccc(cc1)N)c1ccc(cc1)N
Synonyms:- 1,4-Benzenediamine, N1,N1,N4,N4-tetrakis(4-aminophenyl)-
- N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-benzenediamine
- 1,4-Benzenediamine, N,N,N',N'-tetrakis(4-aminophenyl)-
- N,N,N',N'-tetrakis(4-aminophenyl)benzene-1,4-diamine
- N,N,N',N'-Tetrakis-(4-amino-phenyl)-benzene-1,4-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-benzenediamine
CAS:Formula:C30H28N6Purity:95%Color and Shape:SolidMolecular weight:472.5835N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-phenylenediamine
CAS:<p>N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-phenylenediamine</p>Purity:95%Molecular weight:472.58352g/molN,N,N',N'-TETRAKIS(4-AMINOPHENYL)-1,4-PHENYLENEDIAMINE
CAS:Purity:95%Molecular weight:472.59600830078125N,N,N',N'-Tetrakis(4-aminophenyl)-1,4-phenylenediamine
CAS:<p>TPD is a versatile building block and intermediate that is used as a research chemical and speciality chemical. TPD is an important and useful scaffold in organic chemistry, which can be used to produce various compounds. It is also a reagent for the synthesis of low-molecular-weight compounds with a wide range of applications, such as pharmaceuticals, agrochemicals, dyes, fragrances, etc. TPD is soluble in water and can be easily purified by recrystallization or column chromatography. TPD has been shown to have high quality and purity because it does not contain any impurities.</p>Formula:C30H28N6Purity:Min. 95%Color and Shape:Brown PowderMolecular weight:472.59 g/mol




