CAS 32830-01-6
:4-amino-1-(2,5-anhydropentofuranosyl)pyrimidin-2(1H)-one
Description:
4-Amino-1-(2,5-anhydropentofuranosyl)pyrimidin-2(1H)-one, with the CAS number 32830-01-6, is a chemical compound that features a pyrimidine ring substituted with an amino group and a 2,5-anhydropentofuranosyl moiety. This compound is characterized by its heterocyclic structure, which includes nitrogen atoms in the pyrimidine ring, contributing to its potential biological activity. The presence of the anhydro sugar component suggests that it may have properties relevant to nucleoside analogs, which can be significant in medicinal chemistry, particularly in antiviral and anticancer research. The compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Additionally, its structural features may influence its interaction with biological targets, making it a subject of interest for further studies in pharmacology and biochemistry. Overall, this compound exemplifies the intersection of organic chemistry and biological applications, highlighting the importance of structural diversity in drug design.
Formula:C9H11N3O4
InChI:InChI=1/C9H11N3O4/c10-5-1-2-12(9(14)11-5)8-7-6(13)4(16-8)3-15-7/h1-2,4,6-8,13H,3H2,(H2,10,11,14)
SMILES:c1cn(C2C3C(C(CO3)O2)O)c(nc1=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
