CAS 32838-55-4
:2-Benzylpiperidine
Description:
2-Benzylpiperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a benzyl group at the second position. This compound typically appears as a colorless to pale yellow liquid with a distinctive amine-like odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic benzyl group. The presence of the piperidine ring contributes to its basicity, allowing it to act as a weak base in chemical reactions. 2-Benzylpiperidine is of interest in medicinal chemistry and pharmacology, as it may exhibit psychoactive properties and has been studied for its potential applications in drug development. Additionally, it can serve as a building block in the synthesis of various pharmaceuticals and agrochemicals. Safety data indicates that, like many amines, it should be handled with care due to potential irritant effects on the skin and respiratory system.
Formula:C12H17N
InChI:InChI=1S/C12H17N/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12/h1-3,6-7,12-13H,4-5,8-10H2
InChI key:InChIKey=ITXCORRITGNIHP-UHFFFAOYSA-N
SMILES:C(C1=CC=CC=C1)C2CCCCN2
Synonyms:- 2-Benzylpiperidine
- 2-(Phenylmethyl)piperidine
- Piperidine, 2-(phenylmethyl)-
- Piperidine, 2-benzyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Benzylpiperidine
CAS:Controlled Product2-Benzylpiperidine is a reactive compound that has been shown to be active against pancreatic cancer cells. It binds to the pancreatic lipase receptor and inhibits its activity. 2-Benzylpiperidine is also able to inhibit the production of diacylglycerol, a molecule that is involved in inflammatory pain. This compound has an affinity for the receptor, which may be due to its similarity with saponins found in plants such as ginkgo biloba. The dry extract of this plant has been shown to have an inhibition potential on prostaglandin E2 levels, which are responsible for inflammation. 2-Benzylpiperidine can be used for palliative treatment of Alzheimer's disease by reducing amyloid beta plaque formation and preventing oxidative damage.Formula:C12H17NPurity:Min. 90%Color and Shape:Solidified MassMolecular weight:175.27 g/mol


