
CAS 328410-01-1
:1-(3-Bromophenyl)-4-(3-chloropropyl)piperazine
Description:
1-(3-Bromophenyl)-4-(3-chloropropyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 3-bromophenyl group and a 3-chloropropyl substituent, contributing to its unique chemical properties. The presence of halogen atoms (bromine and chlorine) enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The piperazine structure is known for its versatility in forming various derivatives, often utilized in pharmaceuticals for their psychoactive properties. Additionally, the compound's molecular structure suggests potential interactions with neurotransmitter systems, which could be relevant in the development of therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions, such as solvent and temperature. Overall, this compound exemplifies the complexity and diversity of piperazine derivatives in chemical research and drug development.
Formula:C13H18BrClN2
InChI:InChI=1S/C13H18BrClN2/c14-12-3-1-4-13(11-12)17-9-7-16(8-10-17)6-2-5-15/h1,3-4,11H,2,5-10H2
InChI key:InChIKey=TWTYSGFDMRJBII-UHFFFAOYSA-N
SMILES:BrC=1C=C(N2CCN(CCCCl)CC2)C=CC1
Synonyms:- Piperazine, 1-(3-bromophenyl)-4-(3-chloropropyl)-
- 1-(3-Bromophenyl)-4-(3-chloropropyl)piperazine
- 1-(3-Chloropropyl)-4-(3-Bromophenyl)Piperazine
- Trazodone impurity QZT-IM-2-Z2 (impurity Z) hydrochloride
- Trazodone Impurity QZT-IM-2-Z2(Impurity Z)
- Trazodone Impurity QZT-IM-2-Z2(Impurity Z) HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

